C15H24O — CID 162849516
2-[(1R,6R,9S)-1,5,5,8-tetramethyl-9-bicyclo[4.2.1]non-7-enyl]acetaldehyde (PubChem CID 162849516) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-[(1R,6R,9S)-1,5,5,8-tetramethyl-9-bicyclo[4.2.1]non-7-enyl]acetaldehyde.
| Compound Name | 2-[(1R,6R,9S)-1,5,5,8-tetramethyl-9-bicyclo[4.2.1]non-7-enyl]acetaldehyde |
|---|---|
| PubChem CID | 162849516 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2-[(1R,6R,9S)-1,5,5,8-tetramethyl-9-bicyclo[4.2.1]non-7-enyl]acetaldehyde |
| SMILES | CC1=C[C@@H]2[C@H](CC=O)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C15H24O/c1-11-10-13-12(6-9-16)15(11,4)8-5-7-14(13,2)3/h9-10,12-13H,5-8H2,1-4H3/t12-,13+,15-/m0/s1 |
| InChIKey | NLXJLOFFEIORRD-GUTXKFCHSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|