C33H42O9 — CID 162849828
[(1S,2S,3aR,4S,5R,11R,13aS)-3a,4,11-triacetyloxy-2,5,8,8-tetramethyl-9-oxo-1,2,3,4,5,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] 2-phenylacetate (PubChem CID 162849828) has the molecular formula C33H42O9 and a molecular weight of 582.69 g/mol. Its IUPAC name is [(1S,2S,3aR,4S,5R,11R,13aS)-3a,4,11-triacetyloxy-2,5,8,8-tetramethyl-9-oxo-1,2,3,4,5,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] 2-phenylacetate.
| Compound Name | [(1S,2S,3aR,4S,5R,11R,13aS)-3a,4,11-triacetyloxy-2,5,8,8-tetramethyl-9-oxo-1,2,3,4,5,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 162849828 |
| Molecular Formula | C33H42O9 |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | [(1S,2S,3aR,4S,5R,11R,13aS)-3a,4,11-triacetyloxy-2,5,8,8-tetramethyl-9-oxo-1,2,3,4,5,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] 2-phenylacetate |
| SMILES | CC(=O)O[C@H]1C=C[C@H]2[C@@H](OC(=O)Cc3ccccc3)[C@@H](C)C[C@]2(OC(C)=O)[C@@H](OC(C)=O)[C@H](C)C=CC(C)(C)C(=O)C1 |
| InChI | InChI=1S/C33H42O9/c1-20-15-16-32(6,7)28(37)18-26(39-22(3)34)13-14-27-30(41-29(38)17-25-11-9-8-10-12-25)21(2)19-33(27,42-24(5)36)31(20)40-23(4)35/h8-16,20-21,26-27,30-31H,17-19H2,1-7H3/t20-,21+,26+,27+,30+,31+,33-/m1/s1 |
| InChIKey | NGDYOIKDURHVFB-AEMJMOIVSA-N |
| XLogP | 4.71 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|