C21H36O6 — CID 162850372
3-butan-2-yl-2,7-dihydroxy-7-(hydroxymethyl)-4-(3-hydroxypropanoyl)-2,4,5-trimethyl-3,4a,5,6,8,8a-hexahydronaphthalen-1-one (PubChem CID 162850372) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is 3-butan-2-yl-2,7-dihydroxy-7-(hydroxymethyl)-4-(3-hydroxypropanoyl)-2,4,5-trimethyl-3,4a,5,6,8,8a-hexahydronaphthalen-1-one.
| Compound Name | 3-butan-2-yl-2,7-dihydroxy-7-(hydroxymethyl)-4-(3-hydroxypropanoyl)-2,4,5-trimethyl-3,4a,5,6,8,8a-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 162850372 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 3-butan-2-yl-2,7-dihydroxy-7-(hydroxymethyl)-4-(3-hydroxypropanoyl)-2,4,5-trimethyl-3,4a,5,6,8,8a-hexahydronaphthalen-1-one |
| SMILES | CCC(C)C1C(C)(O)C(=O)C2CC(O)(CO)CC(C)C2C1(C)C(=O)CCO |
| InChI | InChI=1S/C21H36O6/c1-6-12(2)17-19(4,15(24)7-8-22)16-13(3)9-21(27,11-23)10-14(16)18(25)20(17,5)26/h12-14,16-17,22-23,26-27H,6-11H2,1-5H3 |
| InChIKey | GZZDPJWUAOGKFV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |