C14H22O2 — CID 162850596
(4S)-4-hydroxy-3,5,5-trimethyl-4-[(E)-3-methylbut-1-enyl]cyclohex-2-en-1-one (PubChem CID 162850596) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (4S)-4-hydroxy-3,5,5-trimethyl-4-[(E)-3-methylbut-1-enyl]cyclohex-2-en-1-one.
| Compound Name | (4S)-4-hydroxy-3,5,5-trimethyl-4-[(E)-3-methylbut-1-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 162850596 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (4S)-4-hydroxy-3,5,5-trimethyl-4-[(E)-3-methylbut-1-enyl]cyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CC(C)(C)[C@@]1(O)/C=C/C(C)C |
| InChI | InChI=1S/C14H22O2/c1-10(2)6-7-14(16)11(3)8-12(15)9-13(14,4)5/h6-8,10,16H,9H2,1-5H3/b7-6+/t14-/m1/s1 |
| InChIKey | MBJNJZDFFRCPNJ-PSKZRQQASA-N |
| XLogP | 2.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|