About 2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane
2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane (PubChem CID 162850722) has the molecular formula C13H10O2
and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane.
Molecular Properties
| Compound Name | 2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane |
| PubChem CID | 162850722 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane |
| SMILES | C=CC1OC1C1OC1C#CC#CC#CC |
| InChI | InChI=1S/C13H10O2/c1-3-5-6-7-8-9-11-13(15-11)12-10(4-2)14-12/h4,10-13H,2H2,1H3 |
| InChIKey | AUFPYJCSAKLTQO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane?
The IUPAC name of 2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane (CID 162850722) is 2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane.
What is the SMILES notation for 2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane?
The canonical SMILES for 2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane is C=CC1OC1C1OC1C#CC#CC#CC.
What is the InChIKey of 2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane?
The InChIKey is AUFPYJCSAKLTQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2/c1-3-5-6-7-8-9-11-13(15-11)12-10(4-2)14-12/h4,10-13H,2H2,1H3.
What are the key properties of 2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane?
2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane has a molecular weight of 198.22 g/mol, XLogP of 0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-3-(3-hepta-1,3,5-triynyloxiran-2-yl)oxirane is sourced from PubChem (CID 162850722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).