C30H46O3 — CID 162850745
(1S,2R,5R,7S,10R,11S,15R,20S,22S)-7-hydroxy-2,6,6,10,17,17-hexamethylhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid (PubChem CID 162850745) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is (1S,2R,5R,7S,10R,11S,15R,20S,22S)-7-hydroxy-2,6,6,10,17,17-hexamethylhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid.
| Compound Name | (1S,2R,5R,7S,10R,11S,15R,20S,22S)-7-hydroxy-2,6,6,10,17,17-hexamethylhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid |
|---|---|
| PubChem CID | 162850745 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | (1S,2R,5R,7S,10R,11S,15R,20S,22S)-7-hydroxy-2,6,6,10,17,17-hexamethylhexacyclo[12.9.0.01,22.02,11.05,10.015,20]tricos-13-ene-20-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)C[C@@H]3C[C@]34C(=CC[C@H]3[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]34C)[C@H]2C1 |
| InChI | InChI=1S/C30H46O3/c1-25(2)13-14-29(24(32)33)15-18-16-30(18)19(20(29)17-25)7-8-22-27(5)11-10-23(31)26(3,4)21(27)9-12-28(22,30)6/h7,18,20-23,31H,8-17H2,1-6H3,(H,32,33)/t18-,20-,21+,22+,23+,27+,28-,29+,30-/m1/s1 |
| InChIKey | LMKPLAZXARISEF-ISEPHOOYSA-N |
| XLogP | 6.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|