C14H22O2 — CID 162850758
(1R,4aR,5S,8S,8aR)-5-ethyl-3-methylspiro[2,4a,5,6,7,8a-hexahydro-1H-naphthalene-8,2'-oxirane]-1-ol (PubChem CID 162850758) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1R,4aR,5S,8S,8aR)-5-ethyl-3-methylspiro[2,4a,5,6,7,8a-hexahydro-1H-naphthalene-8,2'-oxirane]-1-ol.
| Compound Name | (1R,4aR,5S,8S,8aR)-5-ethyl-3-methylspiro[2,4a,5,6,7,8a-hexahydro-1H-naphthalene-8,2'-oxirane]-1-ol |
|---|---|
| PubChem CID | 162850758 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1R,4aR,5S,8S,8aR)-5-ethyl-3-methylspiro[2,4a,5,6,7,8a-hexahydro-1H-naphthalene-8,2'-oxirane]-1-ol |
| SMILES | CC[C@H]1CC[C@@]2(CO2)[C@@H]2[C@H]1C=C(C)C[C@H]2O |
| InChI | InChI=1S/C14H22O2/c1-3-10-4-5-14(8-16-14)13-11(10)6-9(2)7-12(13)15/h6,10-13,15H,3-5,7-8H2,1-2H3/t10-,11-,12+,13+,14+/m0/s1 |
| InChIKey | OWZXGEVKINNJST-ODXJTPSBSA-N |
| XLogP | 2.52 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|