C32H38O14 — CID 162850795
[(1S,2R,3R,4S,5R,6S,7R,9R,12R)-3,4,7,12-tetraacetyloxy-6-(acetyloxymethyl)-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate (PubChem CID 162850795) has the molecular formula C32H38O14 and a molecular weight of 646.64 g/mol. Its IUPAC name is [(1S,2R,3R,4S,5R,6S,7R,9R,12R)-3,4,7,12-tetraacetyloxy-6-(acetyloxymethyl)-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate.
| Compound Name | [(1S,2R,3R,4S,5R,6S,7R,9R,12R)-3,4,7,12-tetraacetyloxy-6-(acetyloxymethyl)-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate |
|---|---|
| PubChem CID | 162850795 |
| Molecular Formula | C32H38O14 |
| Molecular Weight | 646.64 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | [(1S,2R,3R,4S,5R,6S,7R,9R,12R)-3,4,7,12-tetraacetyloxy-6-(acetyloxymethyl)-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate |
| SMILES | CC(=O)OC[C@]12[C@@H](OC(C)=O)C(=O)[C@@H]3[C@@H](OC(C)=O)[C@]1(OC3(C)C)[C@H](C)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H38O14/c1-15-24(41-17(3)34)25(42-18(4)35)28(45-29(39)21-12-10-9-11-13-21)31(14-40-16(2)33)27(44-20(6)37)23(38)22-26(43-19(5)36)32(15,31)46-30(22,7)8/h9-13,15,22,24-28H,14H2,1-8H3/t15-,22-,24-,25+,26-,27+,28+,31-,32-/m1/s1 |
| InChIKey | ISGJNKYYZCPHFR-ZQLSFTHYSA-N |
| XLogP | 1.88 |
| TPSA | 184.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.64 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|