C32H36N2O6 — CID 162851967
[(1S,2R,3R,4S)-3-(1,3-benzodioxol-5-yl)-2-[2-(1,3-benzodioxol-5-yl)ethenyl]-4-(piperidine-1-carbonyl)cyclobutyl]-piperidin-1-ylmethanone (PubChem CID 162851967) has the molecular formula C32H36N2O6 and a molecular weight of 544.65 g/mol. Its IUPAC name is [(1S,2R,3R,4S)-3-(1,3-benzodioxol-5-yl)-2-[2-(1,3-benzodioxol-5-yl)ethenyl]-4-(piperidine-1-carbonyl)cyclobutyl]-piperidin-1-ylmethanone.
| Compound Name | [(1S,2R,3R,4S)-3-(1,3-benzodioxol-5-yl)-2-[2-(1,3-benzodioxol-5-yl)ethenyl]-4-(piperidine-1-carbonyl)cyclobutyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 162851967 |
| Molecular Formula | C32H36N2O6 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | [(1S,2R,3R,4S)-3-(1,3-benzodioxol-5-yl)-2-[2-(1,3-benzodioxol-5-yl)ethenyl]-4-(piperidine-1-carbonyl)cyclobutyl]-piperidin-1-ylmethanone |
| SMILES | O=C([C@@H]1[C@@H](C(=O)N2CCCCC2)[C@H](C=Cc2ccc3c(c2)OCO3)[C@H]1c1ccc2c(c1)OCO2)N1CCCCC1 |
| InChI | InChI=1S/C32H36N2O6/c35-31(33-13-3-1-4-14-33)29-23(10-7-21-8-11-24-26(17-21)39-19-37-24)28(22-9-12-25-27(18-22)40-20-38-25)30(29)32(36)34-15-5-2-6-16-34/h7-12,17-18,23,28-30H,1-6,13-16,19-20H2/t23-,28-,29+,30+/m1/s1 |
| InChIKey | FHGLOMNJXOFZGO-HYPLZALKSA-N |
| XLogP | 4.83 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |