C13H24O12 — CID 162852200
3,4,5,6,7-pentahydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptanal (PubChem CID 162852200) has the molecular formula C13H24O12 and a molecular weight of 372.32 g/mol. Its IUPAC name is 3,4,5,6,7-pentahydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptanal.
| Compound Name | 3,4,5,6,7-pentahydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptanal |
|---|---|
| PubChem CID | 162852200 |
| Molecular Formula | C13H24O12 |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 3,4,5,6,7-pentahydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptanal |
| SMILES | O=CC(OC1OC(CO)C(O)C(O)C1O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C13H24O12/c14-1-4(17)7(18)10(21)8(19)5(2-15)24-13-12(23)11(22)9(20)6(3-16)25-13/h2,4-14,16-23H,1,3H2 |
| InChIKey | PQKZBISFNFBDTF-UHFFFAOYSA-N |
| XLogP | -6.19 |
| TPSA | 217.60 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | -6.19 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|