C33H48O10 — CID 162852436
[1,10-diacetyloxy-3-butanoyloxy-5-methoxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] butanoate (PubChem CID 162852436) has the molecular formula C33H48O10 and a molecular weight of 604.74 g/mol. Its IUPAC name is [1,10-diacetyloxy-3-butanoyloxy-5-methoxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] butanoate.
| Compound Name | [1,10-diacetyloxy-3-butanoyloxy-5-methoxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] butanoate |
|---|---|
| PubChem CID | 162852436 |
| Molecular Formula | C33H48O10 |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | [1,10-diacetyloxy-3-butanoyloxy-5-methoxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-9-yl] butanoate |
| SMILES | C=CC(C)=CCC1(C)C(C)C(OC(=O)CCC)C(OC(C)=O)C23C(=CC(OC)CC12)C(OC(=O)CCC)OC3OC(C)=O |
| InChI | InChI=1S/C33H48O10/c1-10-13-26(36)41-28-20(5)32(8,16-15-19(4)12-3)25-18-23(38-9)17-24-30(42-27(37)14-11-2)43-31(40-22(7)35)33(24,25)29(28)39-21(6)34/h12,15,17,20,23,25,28-31H,3,10-11,13-14,16,18H2,1-2,4-9H3 |
| InChIKey | SOBDSHJYJAAUDH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|