C20H30O — CID 162852612
(1R,2S,5S,6S,9R,12R)-9-methyl-6-[(2R)-6-methylhept-5-en-2-yl]-3-oxatetracyclo[7.3.0.01,5.02,12]dodec-10-ene (PubChem CID 162852612) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (1R,2S,5S,6S,9R,12R)-9-methyl-6-[(2R)-6-methylhept-5-en-2-yl]-3-oxatetracyclo[7.3.0.01,5.02,12]dodec-10-ene.
| Compound Name | (1R,2S,5S,6S,9R,12R)-9-methyl-6-[(2R)-6-methylhept-5-en-2-yl]-3-oxatetracyclo[7.3.0.01,5.02,12]dodec-10-ene |
|---|---|
| PubChem CID | 162852612 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (1R,2S,5S,6S,9R,12R)-9-methyl-6-[(2R)-6-methylhept-5-en-2-yl]-3-oxatetracyclo[7.3.0.01,5.02,12]dodec-10-ene |
| SMILES | CC(C)=CCC[C@@H](C)[C@@H]1CC[C@]2(C)C=C[C@H]3[C@@H]4OC[C@@H]1[C@]342 |
| InChI | InChI=1S/C20H30O/c1-13(2)6-5-7-14(3)15-8-10-19(4)11-9-16-18-20(16,19)17(15)12-21-18/h6,9,11,14-18H,5,7-8,10,12H2,1-4H3/t14-,15+,16+,17+,18+,19-,20-/m1/s1 |
| InChIKey | GTEGAKFMAKUVSB-WLWSEXLFSA-N |
| XLogP | 4.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|