C20H24O7 — CID 162852737
4-[(2R,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-4-hydroxy-3-(hydroxymethyl)oxolan-2-yl]benzene-1,2-diol (PubChem CID 162852737) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is 4-[(2R,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-4-hydroxy-3-(hydroxymethyl)oxolan-2-yl]benzene-1,2-diol.
| Compound Name | 4-[(2R,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-4-hydroxy-3-(hydroxymethyl)oxolan-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 162852737 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 4-[(2R,3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-4-hydroxy-3-(hydroxymethyl)oxolan-2-yl]benzene-1,2-diol |
| SMILES | COc1ccc(C[C@]2(O)CO[C@@H](c3ccc(O)c(O)c3)[C@H]2CO)cc1OC |
| InChI | InChI=1S/C20H24O7/c1-25-17-6-3-12(7-18(17)26-2)9-20(24)11-27-19(14(20)10-21)13-4-5-15(22)16(23)8-13/h3-8,14,19,21-24H,9-11H2,1-2H3/t14-,19+,20+/m1/s1 |
| InChIKey | XQJUJTWUBOZRIA-UAOJZALGSA-N |
| XLogP | 1.77 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|