C16H22O3 — CID 162852769
methyl (2R)-2-[(2R,4aS,8aS)-4a-methyl-8-methylidene-3-oxo-2,4,7,8a-tetrahydro-1H-naphthalen-2-yl]propanoate (PubChem CID 162852769) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl (2R)-2-[(2R,4aS,8aS)-4a-methyl-8-methylidene-3-oxo-2,4,7,8a-tetrahydro-1H-naphthalen-2-yl]propanoate.
| Compound Name | methyl (2R)-2-[(2R,4aS,8aS)-4a-methyl-8-methylidene-3-oxo-2,4,7,8a-tetrahydro-1H-naphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 162852769 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl (2R)-2-[(2R,4aS,8aS)-4a-methyl-8-methylidene-3-oxo-2,4,7,8a-tetrahydro-1H-naphthalen-2-yl]propanoate |
| SMILES | C=C1CC=C[C@]2(C)CC(=O)[C@@H]([C@@H](C)C(=O)OC)C[C@@H]12 |
| InChI | InChI=1S/C16H22O3/c1-10-6-5-7-16(3)9-14(17)12(8-13(10)16)11(2)15(18)19-4/h5,7,11-13H,1,6,8-9H2,2-4H3/t11-,12-,13+,16-/m1/s1 |
| InChIKey | NKPYISZRMBVPTN-NFFDBFGFSA-N |
| XLogP | 2.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|