C15H21Br3O3 — CID 162852816
(2R,3aR,5S,7S,8R,9aR)-7-bromo-5-[(1S)-1-bromopropyl]-2-[(1R)-1-bromoprop-2-ynyl]-3,3a,5,6,7,8,9,9a-octahydro-2H-furo[3,2-b]oxocin-8-ol (PubChem CID 162852816) has the molecular formula C15H21Br3O3 and a molecular weight of 489.04 g/mol. Its IUPAC name is (2R,3aR,5S,7S,8R,9aR)-7-bromo-5-[(1S)-1-bromopropyl]-2-[(1R)-1-bromoprop-2-ynyl]-3,3a,5,6,7,8,9,9a-octahydro-2H-furo[3,2-b]oxocin-8-ol.
| Compound Name | (2R,3aR,5S,7S,8R,9aR)-7-bromo-5-[(1S)-1-bromopropyl]-2-[(1R)-1-bromoprop-2-ynyl]-3,3a,5,6,7,8,9,9a-octahydro-2H-furo[3,2-b]oxocin-8-ol |
|---|---|
| PubChem CID | 162852816 |
| Molecular Formula | C15H21Br3O3 |
| Molecular Weight | 489.04 g/mol |
| Exact Mass | 485.90 |
| IUPAC Name | (2R,3aR,5S,7S,8R,9aR)-7-bromo-5-[(1S)-1-bromopropyl]-2-[(1R)-1-bromoprop-2-ynyl]-3,3a,5,6,7,8,9,9a-octahydro-2H-furo[3,2-b]oxocin-8-ol |
| SMILES | C#C[C@@H](Br)[C@H]1C[C@H]2O[C@H]([C@@H](Br)CC)C[C@H](Br)[C@H](O)C[C@H]2O1 |
| InChI | InChI=1S/C15H21Br3O3/c1-3-8(16)12-5-10(18)11(19)6-14-15(20-12)7-13(21-14)9(17)4-2/h2,8-15,19H,3,5-7H2,1H3/t8-,9+,10-,11+,12-,13+,14+,15+/m0/s1 |
| InChIKey | CYCQRZMWRXZOJA-ZMOOXVQXSA-N |
| XLogP | 3.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.04 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|