C19H26O3 — CID 162853160
[(1R,2S,8aR)-4,7-dimethyl-6-oxo-1-propan-2-yl-2,3,5,8a-tetrahydro-1H-naphthalen-2-yl] (E)-but-2-enoate (PubChem CID 162853160) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is [(1R,2S,8aR)-4,7-dimethyl-6-oxo-1-propan-2-yl-2,3,5,8a-tetrahydro-1H-naphthalen-2-yl] (E)-but-2-enoate.
| Compound Name | [(1R,2S,8aR)-4,7-dimethyl-6-oxo-1-propan-2-yl-2,3,5,8a-tetrahydro-1H-naphthalen-2-yl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 162853160 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | [(1R,2S,8aR)-4,7-dimethyl-6-oxo-1-propan-2-yl-2,3,5,8a-tetrahydro-1H-naphthalen-2-yl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@H]1CC(C)=C2CC(=O)C(C)=C[C@@H]2[C@H]1C(C)C |
| InChI | InChI=1S/C19H26O3/c1-6-7-18(21)22-17-9-12(4)14-10-16(20)13(5)8-15(14)19(17)11(2)3/h6-8,11,15,17,19H,9-10H2,1-5H3/b7-6+/t15-,17-,19+/m0/s1 |
| InChIKey | ZHFWUAVHXOJRBC-WPIQMGCNSA-N |
| XLogP | 4.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|