C24H38O5 — CID 162853711
5-[1,2,4a,5-tetramethyl-4-(2-methylpropanoyloxy)-3-oxo-4,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpentanoic acid (PubChem CID 162853711) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is 5-[1,2,4a,5-tetramethyl-4-(2-methylpropanoyloxy)-3-oxo-4,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpentanoic acid.
| Compound Name | 5-[1,2,4a,5-tetramethyl-4-(2-methylpropanoyloxy)-3-oxo-4,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 162853711 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 5-[1,2,4a,5-tetramethyl-4-(2-methylpropanoyloxy)-3-oxo-4,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpentanoic acid |
| SMILES | CC1=CCCC2C(C)(CCC(C)CC(=O)O)C(C)C(=O)C(OC(=O)C(C)C)C12C |
| InChI | InChI=1S/C24H38O5/c1-14(2)22(28)29-21-20(27)17(5)23(6,12-11-15(3)13-19(25)26)18-10-8-9-16(4)24(18,21)7/h9,14-15,17-18,21H,8,10-13H2,1-7H3,(H,25,26) |
| InChIKey | YGGJHJKVJKTBLF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|