C16H18N2O3 — CID 162854555
prop-2-ynyl 2-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]acetate (PubChem CID 162854555) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is prop-2-ynyl 2-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]acetate.
| Compound Name | prop-2-ynyl 2-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]acetate |
|---|---|
| PubChem CID | 162854555 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | prop-2-ynyl 2-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]acetate |
| SMILES | C#CCOC(=O)CN1C[C@H]2C[C@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C16H18N2O3/c1-2-6-21-16(20)11-17-8-12-7-13(10-17)14-4-3-5-15(19)18(14)9-12/h1,3-5,12-13H,6-11H2/t12-,13-/m1/s1 |
| InChIKey | GTTAIRAAAGNJCZ-CHWSQXEVSA-N |
| XLogP | 0.44 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|