C34H38O9 — CID 162854582
27-(furan-3-yl)-16-hydroxy-2,13,13-trimethyl-8,12,28,31-tetraoxaoctacyclo[15.14.0.01,30.02,27.05,17.06,11.06,14.018,23]hentriacont-24-yne-9,15,29-trione (PubChem CID 162854582) has the molecular formula C34H38O9 and a molecular weight of 590.67 g/mol. Its IUPAC name is 27-(furan-3-yl)-16-hydroxy-2,13,13-trimethyl-8,12,28,31-tetraoxaoctacyclo[15.14.0.01,30.02,27.05,17.06,11.06,14.018,23]hentriacont-24-yne-9,15,29-trione.
| Compound Name | 27-(furan-3-yl)-16-hydroxy-2,13,13-trimethyl-8,12,28,31-tetraoxaoctacyclo[15.14.0.01,30.02,27.05,17.06,11.06,14.018,23]hentriacont-24-yne-9,15,29-trione |
|---|---|
| PubChem CID | 162854582 |
| Molecular Formula | C34H38O9 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 27-(furan-3-yl)-16-hydroxy-2,13,13-trimethyl-8,12,28,31-tetraoxaoctacyclo[15.14.0.01,30.02,27.05,17.06,11.06,14.018,23]hentriacont-24-yne-9,15,29-trione |
| SMILES | CC1(C)OC2CC(=O)OCC23C1C(=O)C(O)C12C4CCCCC4C#CCC4(c5ccoc5)OC(=O)C5OC51C4(C)CCC32 |
| InChI | InChI=1S/C34H38O9/c1-29(2)25-24(36)26(37)33-20-9-5-4-7-18(20)8-6-12-32(19-11-14-39-16-19)30(3,34(33)27(42-34)28(38)43-32)13-10-21(33)31(25)17-40-23(35)15-22(31)41-29/h11,14,16,18,20-22,25-27,37H,4-5,7,9-10,12-13,15,17H2,1-3H3 |
| InChIKey | WKPCMBCAJLKIJQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|