C20H28O8 — CID 162854773
(2R,3R,4S,5S,6R)-2-[(3S)-1,14-dihydroxytetradeca-6,12-dien-8,10-diyn-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 162854773) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(3S)-1,14-dihydroxytetradeca-6,12-dien-8,10-diyn-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(3S)-1,14-dihydroxytetradeca-6,12-dien-8,10-diyn-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162854773 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(3S)-1,14-dihydroxytetradeca-6,12-dien-8,10-diyn-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OCC=CC#CC#CC=CCC[C@@H](CCO)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H28O8/c21-12-9-7-5-3-1-2-4-6-8-10-15(11-13-22)27-20-19(26)18(25)17(24)16(14-23)28-20/h4,6-7,9,15-26H,8,10-14H2/t15-,16+,17+,18-,19+,20+/m0/s1 |
| InChIKey | SRJOBDHLJGPZCW-IEJRGFGGSA-N |
| XLogP | -1.55 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|