C24H35NO5 — CID 162855016
(1S,4Z,6S,7R,10Z,12R,15R,16R,17S)-6,7-dihydroxy-10,14,15-trimethyl-17-(2-methylpropyl)-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,13-triene-3,19-dione (PubChem CID 162855016) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is (1S,4Z,6S,7R,10Z,12R,15R,16R,17S)-6,7-dihydroxy-10,14,15-trimethyl-17-(2-methylpropyl)-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,13-triene-3,19-dione.
| Compound Name | (1S,4Z,6S,7R,10Z,12R,15R,16R,17S)-6,7-dihydroxy-10,14,15-trimethyl-17-(2-methylpropyl)-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,13-triene-3,19-dione |
|---|---|
| PubChem CID | 162855016 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | (1S,4Z,6S,7R,10Z,12R,15R,16R,17S)-6,7-dihydroxy-10,14,15-trimethyl-17-(2-methylpropyl)-2-oxa-18-azatricyclo[10.7.0.01,16]nonadeca-4,10,13-triene-3,19-dione |
| SMILES | CC1=C[C@H]2/C=C(/C)CC[C@@H](O)[C@@H](O)/C=C\C(=O)O[C@@]23C(=O)N[C@@H](CC(C)C)[C@H]3[C@H]1C |
| InChI | InChI=1S/C24H35NO5/c1-13(2)10-18-22-16(5)15(4)12-17-11-14(3)6-7-19(26)20(27)8-9-21(28)30-24(17,22)23(29)25-18/h8-9,11-13,16-20,22,26-27H,6-7,10H2,1-5H3,(H,25,29)/b9-8-,14-11-/t16-,17+,18-,19+,20-,22+,24-/m0/s1 |
| InChIKey | TYOGSRFPSVCJQL-UGGISATESA-N |
| XLogP | 2.66 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|