C32H42N2O6 — CID 162855104
1-[(6-methoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-17-yl)oxy]-3-(3,4,5-trimethoxyphenyl)propan-1-ol (PubChem CID 162855104) has the molecular formula C32H42N2O6 and a molecular weight of 550.70 g/mol. Its IUPAC name is 1-[(6-methoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-17-yl)oxy]-3-(3,4,5-trimethoxyphenyl)propan-1-ol.
| Compound Name | 1-[(6-methoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-17-yl)oxy]-3-(3,4,5-trimethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 162855104 |
| Molecular Formula | C32H42N2O6 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | 1-[(6-methoxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-17-yl)oxy]-3-(3,4,5-trimethoxyphenyl)propan-1-ol |
| SMILES | COc1ccc2c3c([nH]c2c1)C1CC2CCC(OC(O)CCc4cc(OC)c(OC)c(OC)c4)CC2CN1CC3 |
| InChI | InChI=1S/C32H42N2O6/c1-36-22-8-9-24-25-11-12-34-18-21-15-23(7-6-20(21)16-27(34)31(25)33-26(24)17-22)40-30(35)10-5-19-13-28(37-2)32(39-4)29(14-19)38-3/h8-9,13-14,17,20-21,23,27,30,33,35H,5-7,10-12,15-16,18H2,1-4H3 |
| InChIKey | CACUDZIKDKWSSF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|