C10H14Cl2O2 — CID 162855879
[(1E,3R,5Z)-1,6-dichloro-2-methylhepta-1,5-dien-3-yl] acetate (PubChem CID 162855879) has the molecular formula C10H14Cl2O2 and a molecular weight of 237.13 g/mol. Its IUPAC name is [(1E,3R,5Z)-1,6-dichloro-2-methylhepta-1,5-dien-3-yl] acetate.
| Compound Name | [(1E,3R,5Z)-1,6-dichloro-2-methylhepta-1,5-dien-3-yl] acetate |
|---|---|
| PubChem CID | 162855879 |
| Molecular Formula | C10H14Cl2O2 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | [(1E,3R,5Z)-1,6-dichloro-2-methylhepta-1,5-dien-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C/C=C(/C)Cl)/C(C)=C/Cl |
| InChI | InChI=1S/C10H14Cl2O2/c1-7(6-11)10(14-9(3)13)5-4-8(2)12/h4,6,10H,5H2,1-3H3/b7-6+,8-4-/t10-/m1/s1 |
| InChIKey | KMOWUHVWKJIQSZ-RHWILPCQSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |