C28H37NO5 — CID 162856080
17-benzyl-4,5-dihydroxy-5,7,14,15-tetramethyl-13-oxa-18-azatetracyclo[9.8.0.01,16.012,14]nonadec-9-ene-2,19-dione (PubChem CID 162856080) has the molecular formula C28H37NO5 and a molecular weight of 467.61 g/mol. Its IUPAC name is 17-benzyl-4,5-dihydroxy-5,7,14,15-tetramethyl-13-oxa-18-azatetracyclo[9.8.0.01,16.012,14]nonadec-9-ene-2,19-dione.
| Compound Name | 17-benzyl-4,5-dihydroxy-5,7,14,15-tetramethyl-13-oxa-18-azatetracyclo[9.8.0.01,16.012,14]nonadec-9-ene-2,19-dione |
|---|---|
| PubChem CID | 162856080 |
| Molecular Formula | C28H37NO5 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 17-benzyl-4,5-dihydroxy-5,7,14,15-tetramethyl-13-oxa-18-azatetracyclo[9.8.0.01,16.012,14]nonadec-9-ene-2,19-dione |
| SMILES | CC1CC=CC2C3OC3(C)C(C)C3C(Cc4ccccc4)NC(=O)C23C(=O)CC(O)C(C)(O)C1 |
| InChI | InChI=1S/C28H37NO5/c1-16-9-8-12-19-24-27(4,34-24)17(2)23-20(13-18-10-6-5-7-11-18)29-25(32)28(19,23)22(31)14-21(30)26(3,33)15-16/h5-8,10-12,16-17,19-21,23-24,30,33H,9,13-15H2,1-4H3,(H,29,32) |
| InChIKey | WJNMJGWIIFOTSY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|