C32H44O7 — CID 162856294
ethyl (2R,6R)-2-methyl-4-oxo-6-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7,11,12-tetraoxo-2,5,6,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoate (PubChem CID 162856294) has the molecular formula C32H44O7 and a molecular weight of 540.70 g/mol. Its IUPAC name is ethyl (2R,6R)-2-methyl-4-oxo-6-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7,11,12-tetraoxo-2,5,6,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoate.
| Compound Name | ethyl (2R,6R)-2-methyl-4-oxo-6-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7,11,12-tetraoxo-2,5,6,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoate |
|---|---|
| PubChem CID | 162856294 |
| Molecular Formula | C32H44O7 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | ethyl (2R,6R)-2-methyl-4-oxo-6-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7,11,12-tetraoxo-2,5,6,15,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoate |
| SMILES | CCOC(=O)[C@H](C)CC(=O)C[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(C(=O)C(=O)[C@]12C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC3=O |
| InChI | InChI=1S/C32H44O7/c1-9-39-28(38)18(3)15-19(33)14-17(2)20-10-13-31(7)24-21(34)16-22-29(4,5)23(35)11-12-30(22,6)25(24)26(36)27(37)32(20,31)8/h17-18,20,22H,9-16H2,1-8H3/t17-,18-,20-,22+,30+,31+,32+/m1/s1 |
| InChIKey | ORPDHLJFNUXALI-SQPUPFQJSA-N |
| XLogP | 5.03 |
| TPSA | 111.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|