C22H33N3O4S — CID 162856498
2-[(4S,4aR,7R,8R,8aR)-2-acetamido-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-methyl-N-prop-2-enylacetamide (PubChem CID 162856498) has the molecular formula C22H33N3O4S and a molecular weight of 435.59 g/mol. Its IUPAC name is 2-[(4S,4aR,7R,8R,8aR)-2-acetamido-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-methyl-N-prop-2-enylacetamide.
| Compound Name | 2-[(4S,4aR,7R,8R,8aR)-2-acetamido-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-methyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 162856498 |
| Molecular Formula | C22H33N3O4S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-[(4S,4aR,7R,8R,8aR)-2-acetamido-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]-N-methyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(C)C(=O)C[C@@H]1c2nc(NC(C)=O)sc2C[C@H]2[C@](C)(CO)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C22H33N3O4S/c1-6-9-25(5)18(29)10-14-19-15(30-20(24-19)23-13(2)27)11-16-21(14,3)8-7-17(28)22(16,4)12-26/h6,14,16-17,26,28H,1,7-12H2,2-5H3,(H,23,24,27)/t14-,16-,17-,21+,22+/m1/s1 |
| InChIKey | FDXUSXBTMDBYBB-IGGITPCTSA-N |
| XLogP | 2.55 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|