C14H24O — CID 162856916
(3R,6E)-7,11-dimethyldodeca-1,6,10-trien-3-ol (PubChem CID 162856916) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (3R,6E)-7,11-dimethyldodeca-1,6,10-trien-3-ol.
| Compound Name | (3R,6E)-7,11-dimethyldodeca-1,6,10-trien-3-ol |
|---|---|
| PubChem CID | 162856916 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (3R,6E)-7,11-dimethyldodeca-1,6,10-trien-3-ol |
| SMILES | C=C[C@H](O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C14H24O/c1-5-14(15)11-7-10-13(4)9-6-8-12(2)3/h5,8,10,14-15H,1,6-7,9,11H2,2-4H3/b13-10+/t14-/m0/s1 |
| InChIKey | WASNIKZYIWZQIP-UELRPHRMSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|