C20H28O7 — CID 162857332
(1S,4S,6S,8R,9R,12S,13S,14S,16S,17S,18S)-14,17,18-trihydroxy-7,7,17-trimethyl-3,10,20-trioxahexacyclo[14.2.1.16,9.01,13.04,12.08,12]icosan-2-one (PubChem CID 162857332) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is (1S,4S,6S,8R,9R,12S,13S,14S,16S,17S,18S)-14,17,18-trihydroxy-7,7,17-trimethyl-3,10,20-trioxahexacyclo[14.2.1.16,9.01,13.04,12.08,12]icosan-2-one.
| Compound Name | (1S,4S,6S,8R,9R,12S,13S,14S,16S,17S,18S)-14,17,18-trihydroxy-7,7,17-trimethyl-3,10,20-trioxahexacyclo[14.2.1.16,9.01,13.04,12.08,12]icosan-2-one |
|---|---|
| PubChem CID | 162857332 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (1S,4S,6S,8R,9R,12S,13S,14S,16S,17S,18S)-14,17,18-trihydroxy-7,7,17-trimethyl-3,10,20-trioxahexacyclo[14.2.1.16,9.01,13.04,12.08,12]icosan-2-one |
| SMILES | CC1(C)[C@@H]2C[C@@H]3OC(=O)[C@@]45C[C@@H](C[C@H](O)[C@H]4[C@]34CO[C@H](O2)[C@H]14)[C@](C)(O)[C@H]5O |
| InChI | InChI=1S/C20H28O7/c1-17(2)10-5-11-20(7-25-14(26-10)13(17)20)12-9(21)4-8-6-19(12,16(23)27-11)15(22)18(8,3)24/h8-15,21-22,24H,4-7H2,1-3H3/t8-,9+,10+,11+,12-,13-,14-,15-,18+,19+,20+/m1/s1 |
| InChIKey | BGFHWYWPPMAGAE-RVCFVCNJSA-N |
| XLogP | 0.20 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |