C22H30O6 — CID 162857360
4-hydroxy-3-[(3S)-7-hydroxy-3,7-dimethyl-4-oxooct-5-enyl]-5-(4-hydroxy-3-methylbut-2-enyl)benzoic acid (PubChem CID 162857360) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-hydroxy-3-[(3S)-7-hydroxy-3,7-dimethyl-4-oxooct-5-enyl]-5-(4-hydroxy-3-methylbut-2-enyl)benzoic acid.
| Compound Name | 4-hydroxy-3-[(3S)-7-hydroxy-3,7-dimethyl-4-oxooct-5-enyl]-5-(4-hydroxy-3-methylbut-2-enyl)benzoic acid |
|---|---|
| PubChem CID | 162857360 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 4-hydroxy-3-[(3S)-7-hydroxy-3,7-dimethyl-4-oxooct-5-enyl]-5-(4-hydroxy-3-methylbut-2-enyl)benzoic acid |
| SMILES | CC(=CCc1cc(C(=O)O)cc(CC[C@H](C)C(=O)C=CC(C)(C)O)c1O)CO |
| InChI | InChI=1S/C22H30O6/c1-14(13-23)5-7-16-11-18(21(26)27)12-17(20(16)25)8-6-15(2)19(24)9-10-22(3,4)28/h5,9-12,15,23,25,28H,6-8,13H2,1-4H3,(H,26,27)/t15-/m0/s1 |
| InChIKey | MQIPJISWCOTCGQ-HNNXBMFYSA-N |
| XLogP | 3.04 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|