C27H34O16 — CID 162857488
[(2S,3S,4R,5R)-4-acetyloxy-2-[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5-bis(hydroxymethyl)oxolan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 162857488) has the molecular formula C27H34O16 and a molecular weight of 614.55 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-4-acetyloxy-2-[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5-bis(hydroxymethyl)oxolan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2S,3S,4R,5R)-4-acetyloxy-2-[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5-bis(hydroxymethyl)oxolan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162857488 |
| Molecular Formula | C27H34O16 |
| Molecular Weight | 614.55 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | [(2S,3S,4R,5R)-4-acetyloxy-2-[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5-bis(hydroxymethyl)oxolan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | CC(=O)O[C@@H]1[C@@H](CO)O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H]1OC(=O)C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C27H34O16/c1-13(31)37-22-19(11-29)42-27(12-30,25(22)41-20(35)9-6-16-4-7-17(34)8-5-16)43-26-24(39-15(3)33)23(38-14(2)32)21(36)18(10-28)40-26/h4-9,18-19,21-26,28-30,34,36H,10-12H2,1-3H3/t18-,19-,21-,22-,23+,24-,25+,26-,27+/m1/s1 |
| InChIKey | MVGJIEKABGWVCZ-OMCMIWCBSA-N |
| XLogP | -1.71 |
| TPSA | 234.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.55 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|