C20H30O5 — CID 162858706
2-[(1R,3S,6S,14S)-6-hydroxy-6,10,14-trimethyl-7-oxo-15-oxabicyclo[12.1.0]pentadec-10-en-3-yl]prop-2-enoic acid (PubChem CID 162858706) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-[(1R,3S,6S,14S)-6-hydroxy-6,10,14-trimethyl-7-oxo-15-oxabicyclo[12.1.0]pentadec-10-en-3-yl]prop-2-enoic acid.
| Compound Name | 2-[(1R,3S,6S,14S)-6-hydroxy-6,10,14-trimethyl-7-oxo-15-oxabicyclo[12.1.0]pentadec-10-en-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162858706 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-[(1R,3S,6S,14S)-6-hydroxy-6,10,14-trimethyl-7-oxo-15-oxabicyclo[12.1.0]pentadec-10-en-3-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)[C@H]1CC[C@](C)(O)C(=O)CCC(C)=CCC[C@]2(C)O[C@@H]2C1 |
| InChI | InChI=1S/C20H30O5/c1-13-6-5-10-20(4)17(25-20)12-15(14(2)18(22)23)9-11-19(3,24)16(21)8-7-13/h6,15,17,24H,2,5,7-12H2,1,3-4H3,(H,22,23)/t15-,17+,19-,20-/m0/s1 |
| InChIKey | BUGWIYVUMIYWKH-RKOGWWSCSA-N |
| XLogP | 3.41 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|