C20H32O — CID 162858887
(E,6S)-2-methyl-6-[(1R,2S,3S,6R,7S)-6-methyl-10-methylidene-3-tricyclo[5.3.0.02,6]decanyl]hept-3-en-2-ol (PubChem CID 162858887) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (E,6S)-2-methyl-6-[(1R,2S,3S,6R,7S)-6-methyl-10-methylidene-3-tricyclo[5.3.0.02,6]decanyl]hept-3-en-2-ol.
| Compound Name | (E,6S)-2-methyl-6-[(1R,2S,3S,6R,7S)-6-methyl-10-methylidene-3-tricyclo[5.3.0.02,6]decanyl]hept-3-en-2-ol |
|---|---|
| PubChem CID | 162858887 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (E,6S)-2-methyl-6-[(1R,2S,3S,6R,7S)-6-methyl-10-methylidene-3-tricyclo[5.3.0.02,6]decanyl]hept-3-en-2-ol |
| SMILES | C=C1CC[C@H]2[C@@H]1[C@@H]1[C@H]([C@@H](C)C/C=C/C(C)(C)O)CC[C@@]12C |
| InChI | InChI=1S/C20H32O/c1-13(7-6-11-19(3,4)21)15-10-12-20(5)16-9-8-14(2)17(16)18(15)20/h6,11,13,15-18,21H,2,7-10,12H2,1,3-5H3/b11-6+/t13-,15-,16-,17+,18-,20+/m0/s1 |
| InChIKey | IFXAVIPHXWKIGJ-XNYWIMBZSA-N |
| XLogP | 4.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|