C22H42O3 — CID 162859448
(E,7R,8S,18S)-7-hydroxy-8,18-dimethylicos-9-enoic acid (PubChem CID 162859448) has the molecular formula C22H42O3 and a molecular weight of 354.58 g/mol. Its IUPAC name is (E,7R,8S,18S)-7-hydroxy-8,18-dimethylicos-9-enoic acid.
| Compound Name | (E,7R,8S,18S)-7-hydroxy-8,18-dimethylicos-9-enoic acid |
|---|---|
| PubChem CID | 162859448 |
| Molecular Formula | C22H42O3 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.31 |
| IUPAC Name | (E,7R,8S,18S)-7-hydroxy-8,18-dimethylicos-9-enoic acid |
| SMILES | CC[C@H](C)CCCCCCC/C=C/[C@H](C)[C@H](O)CCCCCC(=O)O |
| InChI | InChI=1S/C22H42O3/c1-4-19(2)15-11-8-6-5-7-9-12-16-20(3)21(23)17-13-10-14-18-22(24)25/h12,16,19-21,23H,4-11,13-15,17-18H2,1-3H3,(H,24,25)/b16-12+/t19-,20-,21+/m0/s1 |
| InChIKey | FVAQKIAHIHAUHV-DIMYTHDMSA-N |
| XLogP | 6.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|