C18H28O4 — CID 162859538
4-hydroxy-1,4a-dimethyl-7-(2,2,4-trimethyl-1,3-dioxolan-4-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 162859538) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 4-hydroxy-1,4a-dimethyl-7-(2,2,4-trimethyl-1,3-dioxolan-4-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | 4-hydroxy-1,4a-dimethyl-7-(2,2,4-trimethyl-1,3-dioxolan-4-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 162859538 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 4-hydroxy-1,4a-dimethyl-7-(2,2,4-trimethyl-1,3-dioxolan-4-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | CC1=C2CC(C3(C)COC(C)(C)O3)CCC2(C)C(O)CC1=O |
| InChI | InChI=1S/C18H28O4/c1-11-13-8-12(18(5)10-21-16(2,3)22-18)6-7-17(13,4)15(20)9-14(11)19/h12,15,20H,6-10H2,1-5H3 |
| InChIKey | UDVZEUVTUNRMGI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |