C28H36O5 — CID 162859837
(3S,4R)-6-[(1R)-1-hydroxy-1-[(8R,9S,10R,13R,14R)-14-hydroxy-10,13-dimethyl-1-oxo-7,8,9,11,12,15-hexahydro-4H-cyclopenta[a]phenanthren-17-yl]ethyl]-3,4-dimethyl-3,4-dihydropyran-2-one (PubChem CID 162859837) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is (3S,4R)-6-[(1R)-1-hydroxy-1-[(8R,9S,10R,13R,14R)-14-hydroxy-10,13-dimethyl-1-oxo-7,8,9,11,12,15-hexahydro-4H-cyclopenta[a]phenanthren-17-yl]ethyl]-3,4-dimethyl-3,4-dihydropyran-2-one.
| Compound Name | (3S,4R)-6-[(1R)-1-hydroxy-1-[(8R,9S,10R,13R,14R)-14-hydroxy-10,13-dimethyl-1-oxo-7,8,9,11,12,15-hexahydro-4H-cyclopenta[a]phenanthren-17-yl]ethyl]-3,4-dimethyl-3,4-dihydropyran-2-one |
|---|---|
| PubChem CID | 162859837 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (3S,4R)-6-[(1R)-1-hydroxy-1-[(8R,9S,10R,13R,14R)-14-hydroxy-10,13-dimethyl-1-oxo-7,8,9,11,12,15-hexahydro-4H-cyclopenta[a]phenanthren-17-yl]ethyl]-3,4-dimethyl-3,4-dihydropyran-2-one |
| SMILES | C[C@@H]1C=C([C@](C)(O)C2=CC[C@@]3(O)[C@@H]4CC=C5CC=CC(=O)[C@]5(C)[C@H]4CC[C@]23C)OC(=O)[C@H]1C |
| InChI | InChI=1S/C28H36O5/c1-16-15-23(33-24(30)17(16)2)27(5,31)21-12-14-28(32)20-10-9-18-7-6-8-22(29)26(18,4)19(20)11-13-25(21,28)3/h6,8-9,12,15-17,19-20,31-32H,7,10-11,13-14H2,1-5H3/t16-,17+,19+,20-,25-,26+,27-,28-/m1/s1 |
| InChIKey | PQAWRRWHXZDBCD-YRQWGMKPSA-N |
| XLogP | 4.41 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|