C14H24O5 — CID 162860104
2-[(2R,4S,5R)-4-hydroxy-5-[(1S)-1-hydroxyoct-2-enyl]oxolan-2-yl]acetic acid (PubChem CID 162860104) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-[(2R,4S,5R)-4-hydroxy-5-[(1S)-1-hydroxyoct-2-enyl]oxolan-2-yl]acetic acid.
| Compound Name | 2-[(2R,4S,5R)-4-hydroxy-5-[(1S)-1-hydroxyoct-2-enyl]oxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 162860104 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-[(2R,4S,5R)-4-hydroxy-5-[(1S)-1-hydroxyoct-2-enyl]oxolan-2-yl]acetic acid |
| SMILES | CCCCCC=C[C@H](O)[C@@H]1O[C@@H](CC(=O)O)C[C@@H]1O |
| InChI | InChI=1S/C14H24O5/c1-2-3-4-5-6-7-11(15)14-12(16)8-10(19-14)9-13(17)18/h6-7,10-12,14-16H,2-5,8-9H2,1H3,(H,17,18)/t10-,11+,12+,14+/m1/s1 |
| InChIKey | CCLSDVDYIRVEGS-UHXUPSOCSA-N |
| XLogP | 1.48 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|