C21H33NO7 — CID 162860342
12-hydroxy-N-[(2R,3S,5S,9R,10S)-2,9,10-trihydroxy-6-oxo-1-oxaspiro[4.5]dec-7-en-3-yl]dodec-2-enamide (PubChem CID 162860342) has the molecular formula C21H33NO7 and a molecular weight of 411.50 g/mol. Its IUPAC name is 12-hydroxy-N-[(2R,3S,5S,9R,10S)-2,9,10-trihydroxy-6-oxo-1-oxaspiro[4.5]dec-7-en-3-yl]dodec-2-enamide.
| Compound Name | 12-hydroxy-N-[(2R,3S,5S,9R,10S)-2,9,10-trihydroxy-6-oxo-1-oxaspiro[4.5]dec-7-en-3-yl]dodec-2-enamide |
|---|---|
| PubChem CID | 162860342 |
| Molecular Formula | C21H33NO7 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 12-hydroxy-N-[(2R,3S,5S,9R,10S)-2,9,10-trihydroxy-6-oxo-1-oxaspiro[4.5]dec-7-en-3-yl]dodec-2-enamide |
| SMILES | O=C(C=CCCCCCCCCCO)N[C@H]1C[C@@]2(O[C@H]1O)C(=O)C=C[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C21H33NO7/c23-13-9-7-5-3-1-2-4-6-8-10-18(26)22-15-14-21(29-20(15)28)17(25)12-11-16(24)19(21)27/h8,10-12,15-16,19-20,23-24,27-28H,1-7,9,13-14H2,(H,22,26)/t15-,16+,19-,20+,21+/m0/s1 |
| InChIKey | DQJCNOUNYPRLKJ-ILACCBGSSA-N |
| XLogP | 0.48 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|