C20H30O3 — CID 162861137
2-[(1R,2S,5E,9E,12S,13R)-2-hydroxy-2,6,10-trimethyl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-13-yl]prop-2-enal (PubChem CID 162861137) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-[(1R,2S,5E,9E,12S,13R)-2-hydroxy-2,6,10-trimethyl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-13-yl]prop-2-enal.
| Compound Name | 2-[(1R,2S,5E,9E,12S,13R)-2-hydroxy-2,6,10-trimethyl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-13-yl]prop-2-enal |
|---|---|
| PubChem CID | 162861137 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-[(1R,2S,5E,9E,12S,13R)-2-hydroxy-2,6,10-trimethyl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-13-yl]prop-2-enal |
| SMILES | C=C(C=O)[C@H]1C[C@H]2O[C@H]1C/C(C)=C/CC/C(C)=C/CC[C@]2(C)O |
| InChI | InChI=1S/C20H30O3/c1-14-7-5-8-15(2)11-18-17(16(3)13-21)12-19(23-18)20(4,22)10-6-9-14/h8-9,13,17-19,22H,3,5-7,10-12H2,1-2,4H3/b14-9+,15-8+/t17-,18+,19-,20+/m1/s1 |
| InChIKey | KHSQZSARPVSBBO-ILLHSLNWSA-N |
| XLogP | 4.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|