C18H21NO6 — CID 162861927
methyl (3R,4S,5S)-2-benzyl-3-(furan-2-yl)-5-[(R)-hydroxy(methoxy)methyl]-1,2-oxazolidine-4-carboxylate (PubChem CID 162861927) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is methyl (3R,4S,5S)-2-benzyl-3-(furan-2-yl)-5-[(R)-hydroxy(methoxy)methyl]-1,2-oxazolidine-4-carboxylate.
| Compound Name | methyl (3R,4S,5S)-2-benzyl-3-(furan-2-yl)-5-[(R)-hydroxy(methoxy)methyl]-1,2-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 162861927 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | methyl (3R,4S,5S)-2-benzyl-3-(furan-2-yl)-5-[(R)-hydroxy(methoxy)methyl]-1,2-oxazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]([C@H](O)OC)ON(Cc2ccccc2)[C@H]1c1ccco1 |
| InChI | InChI=1S/C18H21NO6/c1-22-17(20)14-15(13-9-6-10-24-13)19(25-16(14)18(21)23-2)11-12-7-4-3-5-8-12/h3-10,14-16,18,21H,11H2,1-2H3/t14-,15-,16-,18+/m0/s1 |
| InChIKey | RNUIIBQFSACBLH-NBOOPKSLSA-N |
| XLogP | 1.89 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|