C15H18O5 — CID 162862140
9,9a-dihydroxy-5a,9-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2,6-dione (PubChem CID 162862140) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 9,9a-dihydroxy-5a,9-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2,6-dione.
| Compound Name | 9,9a-dihydroxy-5a,9-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2,6-dione |
|---|---|
| PubChem CID | 162862140 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 9,9a-dihydroxy-5a,9-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2,6-dione |
| SMILES | C=C1C(=O)OC2C1CCC1(C)C(=O)C=CC(C)(O)C21O |
| InChI | InChI=1S/C15H18O5/c1-8-9-4-6-13(2)10(16)5-7-14(3,18)15(13,19)11(9)20-12(8)17/h5,7,9,11,18-19H,1,4,6H2,2-3H3 |
| InChIKey | FBMLDARVTYLXKQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|