C27H32O9 — CID 162862673
[(8S,9S,10S)-9,19-dihydroxy-3,4,5-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-yl] 2-methylbut-2-enoate (PubChem CID 162862673) has the molecular formula C27H32O9 and a molecular weight of 500.54 g/mol. Its IUPAC name is [(8S,9S,10S)-9,19-dihydroxy-3,4,5-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-yl] 2-methylbut-2-enoate.
| Compound Name | [(8S,9S,10S)-9,19-dihydroxy-3,4,5-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162862673 |
| Molecular Formula | C27H32O9 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | [(8S,9S,10S)-9,19-dihydroxy-3,4,5-trimethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-8-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)O[C@H]1c2cc(OC)c(OC)c(OC)c2-c2c(cc3c(c2O)OCO3)C[C@H](C)[C@]1(C)O |
| InChI | InChI=1S/C27H32O9/c1-8-13(2)26(29)36-25-16-11-17(31-5)23(32-6)24(33-7)20(16)19-15(9-14(3)27(25,4)30)10-18-22(21(19)28)35-12-34-18/h8,10-11,14,25,28,30H,9,12H2,1-7H3/t14-,25-,27-/m0/s1 |
| InChIKey | BYZKFKFGPLUFIH-PLHUGPHVSA-N |
| XLogP | 4.31 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|