C20H26O12 — CID 162863338
methyl (3R)-3-[(2R,3R,4S,5S,6R)-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-4-hydroxybutanoate (PubChem CID 162863338) has the molecular formula C20H26O12 and a molecular weight of 458.42 g/mol. Its IUPAC name is methyl (3R)-3-[(2R,3R,4S,5S,6R)-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-4-hydroxybutanoate.
| Compound Name | methyl (3R)-3-[(2R,3R,4S,5S,6R)-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-4-hydroxybutanoate |
|---|---|
| PubChem CID | 162863338 |
| Molecular Formula | C20H26O12 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | methyl (3R)-3-[(2R,3R,4S,5S,6R)-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-4-hydroxybutanoate |
| SMILES | COC(=O)C[C@H](CO)O[C@@H]1O[C@H](COC(=O)C=Cc2ccc(O)c(O)c2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H26O12/c1-29-16(25)7-11(8-21)31-20-19(28)18(27)17(26)14(32-20)9-30-15(24)5-3-10-2-4-12(22)13(23)6-10/h2-6,11,14,17-23,26-28H,7-9H2,1H3/t11-,14-,17-,18+,19-,20-/m1/s1 |
| InChIKey | GZDQNTCTPTYRSO-JTADLJFLSA-N |
| XLogP | -1.60 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|