C28H44O9 — CID 162863505
[2-(acetyloxymethyl)-3,5-dihydroxy-6-[(5-hydroxy-4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl)oxy]oxan-4-yl] 2-methylbut-2-enoate (PubChem CID 162863505) has the molecular formula C28H44O9 and a molecular weight of 524.65 g/mol. Its IUPAC name is [2-(acetyloxymethyl)-3,5-dihydroxy-6-[(5-hydroxy-4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl)oxy]oxan-4-yl] 2-methylbut-2-enoate.
| Compound Name | [2-(acetyloxymethyl)-3,5-dihydroxy-6-[(5-hydroxy-4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl)oxy]oxan-4-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162863505 |
| Molecular Formula | C28H44O9 |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | [2-(acetyloxymethyl)-3,5-dihydroxy-6-[(5-hydroxy-4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl)oxy]oxan-4-yl] 2-methylbut-2-enoate |
| SMILES | C=C1CCC(O)C2(C)CCC(C(C)C)C(OC3OC(COC(C)=O)C(O)C(OC(=O)C(C)=CC)C3O)C12 |
| InChI | InChI=1S/C28H44O9/c1-8-15(4)26(33)36-25-22(31)19(13-34-17(6)29)35-27(23(25)32)37-24-18(14(2)3)11-12-28(7)20(30)10-9-16(5)21(24)28/h8,14,18-25,27,30-32H,5,9-13H2,1-4,6-7H3 |
| InChIKey | DFJUSHOWLUVVKC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|