C31H48O2 — CID 162863737
2-hydroxy-4,4,10,13,14-pentamethyl-17-(6-methyl-5-methylideneheptan-2-yl)-5,6,7,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 162863737) has the molecular formula C31H48O2 and a molecular weight of 452.72 g/mol. Its IUPAC name is 2-hydroxy-4,4,10,13,14-pentamethyl-17-(6-methyl-5-methylideneheptan-2-yl)-5,6,7,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 2-hydroxy-4,4,10,13,14-pentamethyl-17-(6-methyl-5-methylideneheptan-2-yl)-5,6,7,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 162863737 |
| Molecular Formula | C31H48O2 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.37 |
| IUPAC Name | 2-hydroxy-4,4,10,13,14-pentamethyl-17-(6-methyl-5-methylideneheptan-2-yl)-5,6,7,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C(CCC(C)C1CCC2(C)C3=C(CCC12C)C1(C)C=C(O)C(=O)C(C)(C)C1CC3)C(C)C |
| InChI | InChI=1S/C31H48O2/c1-19(2)20(3)10-11-21(4)22-14-16-31(9)24-12-13-26-28(5,6)27(33)25(32)18-29(26,7)23(24)15-17-30(22,31)8/h18-19,21-22,26,32H,3,10-17H2,1-2,4-9H3 |
| InChIKey | HCQNHBTVIFBLMZ-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|