C17H20O4 — CID 162863817
(1R,3aR,9aS)-7-methoxy-3a-methyl-1-prop-1-en-2-yl-2,3,9,9a-tetrahydro-1H-cyclopenta[b]chromene-5,8-dione (PubChem CID 162863817) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (1R,3aR,9aS)-7-methoxy-3a-methyl-1-prop-1-en-2-yl-2,3,9,9a-tetrahydro-1H-cyclopenta[b]chromene-5,8-dione.
| Compound Name | (1R,3aR,9aS)-7-methoxy-3a-methyl-1-prop-1-en-2-yl-2,3,9,9a-tetrahydro-1H-cyclopenta[b]chromene-5,8-dione |
|---|---|
| PubChem CID | 162863817 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (1R,3aR,9aS)-7-methoxy-3a-methyl-1-prop-1-en-2-yl-2,3,9,9a-tetrahydro-1H-cyclopenta[b]chromene-5,8-dione |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)OC3=C(C[C@@H]12)C(=O)C(OC)=CC3=O |
| InChI | InChI=1S/C17H20O4/c1-9(2)10-5-6-17(3)12(10)7-11-15(19)14(20-4)8-13(18)16(11)21-17/h8,10,12H,1,5-7H2,2-4H3/t10-,12-,17+/m0/s1 |
| InChIKey | WNIGNVBDYKSWRH-QAGHZCBJSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|