C31H42O6 — CID 162864311
[4-acetyloxy-6-hydroxy-1,4a,6-trimethyl-5-(3-methylpenta-2,4-dienyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 162864311) has the molecular formula C31H42O6 and a molecular weight of 510.67 g/mol. Its IUPAC name is [4-acetyloxy-6-hydroxy-1,4a,6-trimethyl-5-(3-methylpenta-2,4-dienyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [4-acetyloxy-6-hydroxy-1,4a,6-trimethyl-5-(3-methylpenta-2,4-dienyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162864311 |
| Molecular Formula | C31H42O6 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | [4-acetyloxy-6-hydroxy-1,4a,6-trimethyl-5-(3-methylpenta-2,4-dienyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | C=CC(C)=CCC1C(C)(O)CCC2C(C)(COC(=O)C=Cc3ccc(O)cc3)CCC(OC(C)=O)C12C |
| InChI | InChI=1S/C31H42O6/c1-7-21(2)8-14-26-30(5,35)19-16-25-29(4,18-17-27(31(25,26)6)37-22(3)32)20-36-28(34)15-11-23-9-12-24(33)13-10-23/h7-13,15,25-27,33,35H,1,14,16-20H2,2-6H3 |
| InChIKey | OZHDEGRCZAFFLC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|