C11H12N2O2 — CID 162864425
6-hydroxy-2,3,4,4a,9,9a-hexahydropyrido[3,4-b]indol-1-one (PubChem CID 162864425) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 6-hydroxy-2,3,4,4a,9,9a-hexahydropyrido[3,4-b]indol-1-one.
| Compound Name | 6-hydroxy-2,3,4,4a,9,9a-hexahydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 162864425 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 6-hydroxy-2,3,4,4a,9,9a-hexahydropyrido[3,4-b]indol-1-one |
| SMILES | O=C1NCCC2c3cc(O)ccc3NC12 |
| InChI | InChI=1S/C11H12N2O2/c14-6-1-2-9-8(5-6)7-3-4-12-11(15)10(7)13-9/h1-2,5,7,10,13-14H,3-4H2,(H,12,15) |
| InChIKey | YPWANZCXVOBHHZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|