C26H38O4 — CID 162864614
methyl (1S,4S,5S,6R,9S,10R,13R)-5,9-dimethyl-6-(3-methylbut-2-enoyloxy)-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 162864614) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is methyl (1S,4S,5S,6R,9S,10R,13R)-5,9-dimethyl-6-(3-methylbut-2-enoyloxy)-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | methyl (1S,4S,5S,6R,9S,10R,13R)-5,9-dimethyl-6-(3-methylbut-2-enoyloxy)-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 162864614 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | methyl (1S,4S,5S,6R,9S,10R,13R)-5,9-dimethyl-6-(3-methylbut-2-enoyloxy)-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | C=C1C[C@@]23CC[C@H]4[C@@](C)(CC[C@@H](OC(=O)C=C(C)C)[C@@]4(C)C(=O)OC)[C@@H]2CC[C@@H]1C3 |
| InChI | InChI=1S/C26H38O4/c1-16(2)13-22(27)30-21-10-11-24(4)19(25(21,5)23(28)29-6)9-12-26-14-17(3)18(15-26)7-8-20(24)26/h13,18-21H,3,7-12,14-15H2,1-2,4-6H3/t18-,19+,20+,21-,24-,25+,26-/m1/s1 |
| InChIKey | ZYSFUPUEWMTDAO-NZHHMDKPSA-N |
| XLogP | 5.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|