C22H36O3 — CID 162864723
(1R,3aE,6E,10R,10aR)-1,3-dimethoxy-7-methyl-10-[(2S)-6-methylhept-5-en-2-yl]-3,5,8,9,10,10a-hexahydro-1H-cyclonona[c]furan (PubChem CID 162864723) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (1R,3aE,6E,10R,10aR)-1,3-dimethoxy-7-methyl-10-[(2S)-6-methylhept-5-en-2-yl]-3,5,8,9,10,10a-hexahydro-1H-cyclonona[c]furan.
| Compound Name | (1R,3aE,6E,10R,10aR)-1,3-dimethoxy-7-methyl-10-[(2S)-6-methylhept-5-en-2-yl]-3,5,8,9,10,10a-hexahydro-1H-cyclonona[c]furan |
|---|---|
| PubChem CID | 162864723 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (1R,3aE,6E,10R,10aR)-1,3-dimethoxy-7-methyl-10-[(2S)-6-methylhept-5-en-2-yl]-3,5,8,9,10,10a-hexahydro-1H-cyclonona[c]furan |
| SMILES | COC1O[C@@H](OC)[C@H]2/C1=C\C/C=C(\C)CC[C@@H]2[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C22H36O3/c1-15(2)9-7-11-17(4)18-14-13-16(3)10-8-12-19-20(18)22(24-6)25-21(19)23-5/h9-10,12,17-18,20-22H,7-8,11,13-14H2,1-6H3/b16-10+,19-12+/t17-,18+,20+,21?,22+/m0/s1 |
| InChIKey | ZETHHMPKDUSZQQ-QRUCQFDWSA-N |
| XLogP | 5.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|