C39H74NO7P — CID 162864754
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octadeca-1,11-dienoxypropan-2-yl] hexadec-9-enoate (PubChem CID 162864754) has the molecular formula C39H74NO7P and a molecular weight of 700.00 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octadeca-1,11-dienoxypropan-2-yl] hexadec-9-enoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octadeca-1,11-dienoxypropan-2-yl] hexadec-9-enoate |
|---|---|
| PubChem CID | 162864754 |
| Molecular Formula | C39H74NO7P |
| Molecular Weight | 700.00 g/mol |
| Exact Mass | 699.52 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octadeca-1,11-dienoxypropan-2-yl] hexadec-9-enoate |
| SMILES | CCCCCCC=CCCCCCCCCC=COC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCCC=CCCCCCC |
| InChI | InChI=1S/C39H74NO7P/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-34-44-36-38(37-46-48(42,43)45-35-33-40)47-39(41)32-30-28-26-24-22-20-16-14-12-10-8-6-4-2/h13-16,31,34,38H,3-12,17-30,32-33,35-37,40H2,1-2H3,(H,42,43)/t38-/m1/s1 |
| InChIKey | VOXTUTPXXDMGBT-KXQOOQHDSA-N |
| XLogP | 11.43 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.00 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|